C17H18F3N5O2 — CID 4771156
N-[3-(dimethylamino)propyl]-5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 4771156) has the molecular formula C17H18F3N5O2 and a molecular weight of 381.36 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 4771156 |
| Molecular Formula | C17H18F3N5O2 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cnn2c(C(F)(F)F)cc(-c3ccco3)nc12 |
| InChI | InChI=1S/C17H18F3N5O2/c1-24(2)7-4-6-21-16(26)11-10-22-25-14(17(18,19)20)9-12(23-15(11)25)13-5-3-8-27-13/h3,5,8-10H,4,6-7H2,1-2H3,(H,21,26) |
| InChIKey | BRPAZZRSYWLIAP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|