C15H16BrN5O2S2 — CID 4771336
5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide (PubChem CID 4771336) has the molecular formula C15H16BrN5O2S2 and a molecular weight of 442.36 g/mol. Its IUPAC name is 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4771336 |
| Molecular Formula | C15H16BrN5O2S2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2ccc(Cn3nc(C)c(Br)c3C)o2)s1 |
| InChI | InChI=1S/C15H16BrN5O2S2/c1-4-24-15-19-18-14(25-15)17-13(22)11-6-5-10(23-11)7-21-9(3)12(16)8(2)20-21/h5-6H,4,7H2,1-3H3,(H,17,18,22) |
| InChIKey | CACCHXWXOSIDJS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|