C15H25N5O3 — CID 4772218
3-(3-nitropyrazol-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide (PubChem CID 4772218) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-(3-nitropyrazol-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide.
| Compound Name | 3-(3-nitropyrazol-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 4772218 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-(3-nitropyrazol-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
| SMILES | CC1(C)CC(NC(=O)CCn2ccc([N+](=O)[O-])n2)CC(C)(C)N1 |
| InChI | InChI=1S/C15H25N5O3/c1-14(2)9-11(10-15(3,4)18-14)16-13(21)6-8-19-7-5-12(17-19)20(22)23/h5,7,11,18H,6,8-10H2,1-4H3,(H,16,21) |
| InChIKey | ZKBBQBUBYJAVFT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|