About 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide
2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide (PubChem CID 4773800) has the molecular formula C10H10F3N5O
and a molecular weight of 273.22 g/mol. Its IUPAC name is 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide |
| PubChem CID | 4773800 |
| Molecular Formula | C10H10F3N5O |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3N5O/c1-17-8(2-3-14-17)9(19)16-7-4-15-18(5-7)6-10(11,12)13/h2-5H,6H2,1H3,(H,16,19) |
| InChIKey | HFZAGRMSLYVDDZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide?
The IUPAC name of 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide (CID 4773800) is 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide.
What is the SMILES notation for 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide?
The canonical SMILES for 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide is Cn1nccc1C(=O)Nc1cnn(CC(F)(F)F)c1.
What is the InChIKey of 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide?
The InChIKey is HFZAGRMSLYVDDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3N5O/c1-17-8(2-3-14-17)9(19)16-7-4-15-18(5-7)6-10(11,12)13/h2-5H,6H2,1H3,(H,16,19).
What are the key properties of 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide?
2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide has a molecular weight of 273.22 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazole-3-carboxamide is sourced from PubChem (CID 4773800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).