About 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide
1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide (PubChem CID 4773813) has the molecular formula C7H9F2N3O
and a molecular weight of 189.17 g/mol. Its IUPAC name is 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide |
| PubChem CID | 4773813 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C(F)F)c(C)c1C(N)=O |
| InChI | InChI=1S/C7H9F2N3O/c1-3-5(6(10)13)4(2)12(11-3)7(8)9/h7H,1-2H3,(H2,10,13) |
| InChIKey | VBZLTSYAKIIJBP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide?
The IUPAC name of 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide (CID 4773813) is 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide.
What is the SMILES notation for 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide?
The canonical SMILES for 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide is Cc1nn(C(F)F)c(C)c1C(N)=O.
What is the InChIKey of 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide?
The InChIKey is VBZLTSYAKIIJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N3O/c1-3-5(6(10)13)4(2)12(11-3)7(8)9/h7H,1-2H3,(H2,10,13).
What are the key properties of 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide?
1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide has a molecular weight of 189.17 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-3,5-dimethylpyrazole-4-carboxamide is sourced from PubChem (CID 4773813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).