C17H13ClFN3O2 — CID 4774958
1-[(2-chlorophenoxy)methyl]-N-(2-fluorophenyl)pyrazole-3-carboxamide (PubChem CID 4774958) has the molecular formula C17H13ClFN3O2 and a molecular weight of 345.76 g/mol. Its IUPAC name is 1-[(2-chlorophenoxy)methyl]-N-(2-fluorophenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2-chlorophenoxy)methyl]-N-(2-fluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4774958 |
| Molecular Formula | C17H13ClFN3O2 |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-[(2-chlorophenoxy)methyl]-N-(2-fluorophenyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1ccn(COc2ccccc2Cl)n1 |
| InChI | InChI=1S/C17H13ClFN3O2/c18-12-5-1-4-8-16(12)24-11-22-10-9-15(21-22)17(23)20-14-7-3-2-6-13(14)19/h1-10H,11H2,(H,20,23) |
| InChIKey | HPRJGVYMWQAZSB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |