C17H25FN2O4 — CID 47749624
3-ethoxy-N-[3-fluoro-4-(2-methoxyethoxy)phenyl]piperidine-1-carboxamide (PubChem CID 47749624) has the molecular formula C17H25FN2O4 and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-ethoxy-N-[3-fluoro-4-(2-methoxyethoxy)phenyl]piperidine-1-carboxamide.
| Compound Name | 3-ethoxy-N-[3-fluoro-4-(2-methoxyethoxy)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 47749624 |
| Molecular Formula | C17H25FN2O4 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-ethoxy-N-[3-fluoro-4-(2-methoxyethoxy)phenyl]piperidine-1-carboxamide |
| SMILES | CCOC1CCCN(C(=O)Nc2ccc(OCCOC)c(F)c2)C1 |
| InChI | InChI=1S/C17H25FN2O4/c1-3-23-14-5-4-8-20(12-14)17(21)19-13-6-7-16(15(18)11-13)24-10-9-22-2/h6-7,11,14H,3-5,8-10,12H2,1-2H3,(H,19,21) |
| InChIKey | IXQYEVKQSTVILD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|