C17H13FN4 — CID 4774984
6-(4-fluorophenyl)-11,13-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene (PubChem CID 4774984) has the molecular formula C17H13FN4 and a molecular weight of 292.32 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-11,13-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene.
| Compound Name | 6-(4-fluorophenyl)-11,13-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 4774984 |
| Molecular Formula | C17H13FN4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 6-(4-fluorophenyl)-11,13-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
| SMILES | Cc1cc(C)c2c(n1)nn1c(-c3ccc(F)cc3)ccnc21 |
| InChI | InChI=1S/C17H13FN4/c1-10-9-11(2)20-16-15(10)17-19-8-7-14(22(17)21-16)12-3-5-13(18)6-4-12/h3-9H,1-2H3 |
| InChIKey | OHZVQEXXSVNFCX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |