C10H11Br2N3OS2 — CID 4775402
3-(4,5-dibromothiophen-2-yl)-4-(3-methoxypropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 4775402) has the molecular formula C10H11Br2N3OS2 and a molecular weight of 413.16 g/mol. Its IUPAC name is 3-(4,5-dibromothiophen-2-yl)-4-(3-methoxypropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4,5-dibromothiophen-2-yl)-4-(3-methoxypropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4775402 |
| Molecular Formula | C10H11Br2N3OS2 |
| Molecular Weight | 413.16 g/mol |
| Exact Mass | 410.87 |
| IUPAC Name | 3-(4,5-dibromothiophen-2-yl)-4-(3-methoxypropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COCCCn1c(-c2cc(Br)c(Br)s2)n[nH]c1=S |
| InChI | InChI=1S/C10H11Br2N3OS2/c1-16-4-2-3-15-9(13-14-10(15)17)7-5-6(11)8(12)18-7/h5H,2-4H2,1H3,(H,14,17) |
| InChIKey | OTMPERVTKJHTQX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.16 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|