C12H8BrF2N7O3S — CID 4775462
4-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 4775462) has the molecular formula C12H8BrF2N7O3S and a molecular weight of 448.21 g/mol. Its IUPAC name is 4-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4775462 |
| Molecular Formula | C12H8BrF2N7O3S |
| Molecular Weight | 448.21 g/mol |
| Exact Mass | 446.96 |
| IUPAC Name | 4-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1nn(Cc2ccc(C=Nn3c(C(F)F)n[nH]c3=S)o2)cc1Br |
| InChI | InChI=1S/C12H8BrF2N7O3S/c13-8-5-20(19-10(8)22(23)24)4-7-2-1-6(25-7)3-16-21-11(9(14)15)17-18-12(21)26/h1-3,5,9H,4H2,(H,18,26) |
| InChIKey | NPRDPFZIISXSCS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|