C13H9ClF2N6S — CID 4775916
4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 4775916) has the molecular formula C13H9ClF2N6S and a molecular weight of 354.77 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4775916 |
| Molecular Formula | C13H9ClF2N6S |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)c1n[nH]c(=S)n1N=Cc1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H9ClF2N6S/c14-9-3-1-7(2-4-9)10-8(5-17-19-10)6-18-22-12(11(15)16)20-21-13(22)23/h1-6,11H,(H,17,19)(H,21,23) |
| InChIKey | ZGLIVANSTKPHQK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|