C13H12F4N4O — CID 4775945
N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanimine (PubChem CID 4775945) has the molecular formula C13H12F4N4O and a molecular weight of 316.26 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanimine.
| Compound Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 4775945 |
| Molecular Formula | C13H12F4N4O |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanimine |
| SMILES | Cc1nnc(C)n1N=Cc1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H12F4N4O/c1-8-19-20-9(2)21(8)18-7-10-4-3-5-11(6-10)22-13(16,17)12(14)15/h3-7,12H,1-2H3 |
| InChIKey | YDMDZJQFPLHCHP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|