C19H22N10 — CID 4776666
10-methyl-4-[3-(5-methyltetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4776666) has the molecular formula C19H22N10 and a molecular weight of 390.46 g/mol. Its IUPAC name is 10-methyl-4-[3-(5-methyltetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-methyl-4-[3-(5-methyltetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4776666 |
| Molecular Formula | C19H22N10 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 10-methyl-4-[3-(5-methyltetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1nnn(C23CC4CC(CC(c5nc6c7cnn(C)c7ncn6n5)(C4)C2)C3)n1 |
| InChI | InChI=1S/C19H22N10/c1-11-23-26-29(24-11)19-6-12-3-13(7-19)5-18(4-12,9-19)17-22-16-14-8-21-27(2)15(14)20-10-28(16)25-17/h8,10,12-13H,3-7,9H2,1-2H3 |
| InChIKey | JUODUGCIVCXISF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 104.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |