C14H18ClN5O3 — CID 4776743
methyl 4-[2-(4-chloro-5-methylpyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxylate (PubChem CID 4776743) has the molecular formula C14H18ClN5O3 and a molecular weight of 339.78 g/mol. Its IUPAC name is methyl 4-[2-(4-chloro-5-methylpyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxylate.
| Compound Name | methyl 4-[2-(4-chloro-5-methylpyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 4776743 |
| Molecular Formula | C14H18ClN5O3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | methyl 4-[2-(4-chloro-5-methylpyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxylate |
| SMILES | CCn1cc(NC(=O)C(C)n2ncc(Cl)c2C)c(C(=O)OC)n1 |
| InChI | InChI=1S/C14H18ClN5O3/c1-5-19-7-11(12(18-19)14(22)23-4)17-13(21)9(3)20-8(2)10(15)6-16-20/h6-7,9H,5H2,1-4H3,(H,17,21) |
| InChIKey | RCEQYUZPFILGLU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |