C18H13BrN6S — CID 4776746
4-(4-bromo-5-ethylthiophen-2-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4776746) has the molecular formula C18H13BrN6S and a molecular weight of 425.32 g/mol. Its IUPAC name is 4-(4-bromo-5-ethylthiophen-2-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-(4-bromo-5-ethylthiophen-2-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4776746 |
| Molecular Formula | C18H13BrN6S |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 4-(4-bromo-5-ethylthiophen-2-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCc1sc(-c2nc3c4cnn(-c5ccccc5)c4ncn3n2)cc1Br |
| InChI | InChI=1S/C18H13BrN6S/c1-2-14-13(19)8-15(26-14)16-22-18-12-9-21-25(11-6-4-3-5-7-11)17(12)20-10-24(18)23-16/h3-10H,2H2,1H3 |
| InChIKey | FTHDIDKLXHFZCF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |