C14H10F2N6O — CID 4776831
4-[2-(difluoromethoxy)phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4776831) has the molecular formula C14H10F2N6O and a molecular weight of 316.27 g/mol. Its IUPAC name is 4-[2-(difluoromethoxy)phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[2-(difluoromethoxy)phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4776831 |
| Molecular Formula | C14H10F2N6O |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-[2-(difluoromethoxy)phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cn1ncc2c1ncn1nc(-c3ccccc3OC(F)F)nc21 |
| InChI | InChI=1S/C14H10F2N6O/c1-21-12-9(6-18-21)13-19-11(20-22(13)7-17-12)8-4-2-3-5-10(8)23-14(15)16/h2-7,14H,1H3 |
| InChIKey | BCFWSSSBOAHRHX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |