C22H20N6O2 — CID 4777006
4-[4-[(4-ethoxyphenoxy)methyl]phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4777006) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[4-[(4-ethoxyphenoxy)methyl]phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[4-[(4-ethoxyphenoxy)methyl]phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4777006 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-[4-[(4-ethoxyphenoxy)methyl]phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCOc1ccc(OCc2ccc(-c3nc4c5cnn(C)c5ncn4n3)cc2)cc1 |
| InChI | InChI=1S/C22H20N6O2/c1-3-29-17-8-10-18(11-9-17)30-13-15-4-6-16(7-5-15)20-25-22-19-12-24-27(2)21(19)23-14-28(22)26-20/h4-12,14H,3,13H2,1-2H3 |
| InChIKey | VDDHECBSDNUMIB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |