About 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one
2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 47771908) has the molecular formula C16H10F3N3O4
and a molecular weight of 365.27 g/mol. Its IUPAC name is 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 47771908 |
| Molecular Formula | C16H10F3N3O4 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(COc2ccc([N+](=O)[O-])cc2C(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C16H10F3N3O4/c17-16(18,19)12-8-11(22(24)25)4-5-13(12)26-9-10-7-15(23)21-6-2-1-3-14(21)20-10/h1-8H,9H2 |
| InChIKey | BTFOJEVUWAXPJG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one (CID 47771908) is 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one is O=c1cc(COc2ccc([N+](=O)[O-])cc2C(F)(F)F)nc2ccccn12.
What is the InChIKey of 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is BTFOJEVUWAXPJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F3N3O4/c17-16(18,19)12-8-11(22(24)25)4-5-13(12)26-9-10-7-15(23)21-6-2-1-3-14(21)20-10/h1-8H,9H2.
What are the key properties of 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one?
2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 365.27 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 47771908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).