C19H16N4O2S2 — CID 47772433
3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 47772433) has the molecular formula C19H16N4O2S2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47772433 |
| Molecular Formula | C19H16N4O2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | CSc1nnc(CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)s1 |
| InChI | InChI=1S/C19H16N4O2S2/c1-26-18-22-21-15(27-18)12-23-16(24)19(20-17(23)25,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,12H2,1H3,(H,20,25) |
| InChIKey | FGZCPIKUMGVFCB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|