C16H24N4O3S — CID 47774067
3-[4-(furan-2-ylmethyl)-5-[2-[(2-methylpropan-2-yl)oxy]ethylsulfanyl]-1,2,4-triazol-3-yl]propanamide (PubChem CID 47774067) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-[4-(furan-2-ylmethyl)-5-[2-[(2-methylpropan-2-yl)oxy]ethylsulfanyl]-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 3-[4-(furan-2-ylmethyl)-5-[2-[(2-methylpropan-2-yl)oxy]ethylsulfanyl]-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 47774067 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-[4-(furan-2-ylmethyl)-5-[2-[(2-methylpropan-2-yl)oxy]ethylsulfanyl]-1,2,4-triazol-3-yl]propanamide |
| SMILES | CC(C)(C)OCCSc1nnc(CCC(N)=O)n1Cc1ccco1 |
| InChI | InChI=1S/C16H24N4O3S/c1-16(2,3)23-9-10-24-15-19-18-14(7-6-13(17)21)20(15)11-12-5-4-8-22-12/h4-5,8H,6-7,9-11H2,1-3H3,(H2,17,21) |
| InChIKey | GSHQUEAPFJRJSP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|