C13H16N2O — CID 4777842
8-ethoxy-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 4777842) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 8-ethoxy-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-ethoxy-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 4777842 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 8-ethoxy-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | CCOc1ccc2[nH]c3c(c2c1)CNCC3 |
| InChI | InChI=1S/C13H16N2O/c1-2-16-9-3-4-12-10(7-9)11-8-14-6-5-13(11)15-12/h3-4,7,14-15H,2,5-6,8H2,1H3 |
| InChIKey | MQVSQAVRUZMEJP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|