C27H30N2O3S — CID 4777920
N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-2,2-diphenylacetamide (PubChem CID 4777920) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4777920 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-2,2-diphenylacetamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N2O3S/c1-29(24-15-9-4-10-16-24)33(31,32)25-19-17-23(18-20-25)28-27(30)26(21-11-5-2-6-12-21)22-13-7-3-8-14-22/h2-3,5-8,11-14,17-20,24,26H,4,9-10,15-16H2,1H3,(H,28,30) |
| InChIKey | NTLHSJAPOYFZNG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |