C16H21N7O3S — CID 47780393
3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 47780393) has the molecular formula C16H21N7O3S and a molecular weight of 391.46 g/mol. Its IUPAC name is 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 47780393 |
| Molecular Formula | C16H21N7O3S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCCCCc1nnc(NC(=O)CCc2nc3c([nH]2)c(=O)[nH]c(=O)n3C)s1 |
| InChI | InChI=1S/C16H21N7O3S/c1-3-4-5-6-11-21-22-15(27-11)19-10(24)8-7-9-17-12-13(18-9)23(2)16(26)20-14(12)25/h3-8H2,1-2H3,(H,17,18)(H,19,22,24)(H,20,25,26) |
| InChIKey | XMMWDSBJBWLQRN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 138.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|