C21H21F2N3O4 — CID 47783140
N-[1-[2-(difluoromethoxy)phenyl]propyl]-4-(3,6-dioxodiazinan-1-yl)benzamide (PubChem CID 47783140) has the molecular formula C21H21F2N3O4 and a molecular weight of 417.41 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]propyl]-4-(3,6-dioxodiazinan-1-yl)benzamide.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]propyl]-4-(3,6-dioxodiazinan-1-yl)benzamide |
|---|---|
| PubChem CID | 47783140 |
| Molecular Formula | C21H21F2N3O4 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]propyl]-4-(3,6-dioxodiazinan-1-yl)benzamide |
| SMILES | CCC(NC(=O)c1ccc(N2NC(=O)CCC2=O)cc1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C21H21F2N3O4/c1-2-16(15-5-3-4-6-17(15)30-21(22)23)24-20(29)13-7-9-14(10-8-13)26-19(28)12-11-18(27)25-26/h3-10,16,21H,2,11-12H2,1H3,(H,24,29)(H,25,27) |
| InChIKey | RIHJAZUDUFTIEM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |