C9H7ClN2O — CID 4778793
3-(4-chlorophenyl)-1,4-dihydropyrazol-5-one (PubChem CID 4778793) has the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,4-dihydropyrazol-5-one.
| Compound Name | 3-(4-chlorophenyl)-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 4778793 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 3-(4-chlorophenyl)-1,4-dihydropyrazol-5-one |
| SMILES | O=C1CC(c2ccc(Cl)cc2)=NN1 |
| InChI | InChI=1S/C9H7ClN2O/c10-7-3-1-6(2-4-7)8-5-9(13)12-11-8/h1-4H,5H2,(H,12,13) |
| InChIKey | NHTDROBHTXFJCI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |