C15H12Cl3NO2 — CID 4779142
2,4-dichloro-N-(5-chloro-2-ethoxyphenyl)benzamide (PubChem CID 4779142) has the molecular formula C15H12Cl3NO2 and a molecular weight of 344.63 g/mol. Its IUPAC name is 2,4-dichloro-N-(5-chloro-2-ethoxyphenyl)benzamide.
| Compound Name | 2,4-dichloro-N-(5-chloro-2-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 4779142 |
| Molecular Formula | C15H12Cl3NO2 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 2,4-dichloro-N-(5-chloro-2-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(Cl)cc1NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl3NO2/c1-2-21-14-6-4-10(17)8-13(14)19-15(20)11-5-3-9(16)7-12(11)18/h3-8H,2H2,1H3,(H,19,20) |
| InChIKey | KOUDSIBDKSIETG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |