C21H26N4O3 — CID 47794929
2-(1,3-dimethylbenzimidazol-2-ylidene)-6-(3,3-dimethylmorpholin-4-yl)-3,6-dioxohexanenitrile (PubChem CID 47794929) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(1,3-dimethylbenzimidazol-2-ylidene)-6-(3,3-dimethylmorpholin-4-yl)-3,6-dioxohexanenitrile.
| Compound Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-6-(3,3-dimethylmorpholin-4-yl)-3,6-dioxohexanenitrile |
|---|---|
| PubChem CID | 47794929 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-6-(3,3-dimethylmorpholin-4-yl)-3,6-dioxohexanenitrile |
| SMILES | CN1C(=C(C#N)C(=O)CCC(=O)N2CCOCC2(C)C)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H26N4O3/c1-21(2)14-28-12-11-25(21)19(27)10-9-18(26)15(13-22)20-23(3)16-7-5-6-8-17(16)24(20)4/h5-8H,9-12,14H2,1-4H3 |
| InChIKey | KJUALBUSLSRLSC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|