About N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide
N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide (PubChem CID 4779513) has the molecular formula C17H15N3O5
and a molecular weight of 341.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide |
| PubChem CID | 4779513 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N3O5/c21-17(19-12-4-6-15-16(8-12)25-9-24-15)10-1-5-13(18-11-2-3-11)14(7-10)20(22)23/h1,4-8,11,18H,2-3,9H2,(H,19,21) |
| InChIKey | VXMCIQNUHLKITJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide (CID 4779513) is N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide is O=C(Nc1ccc2c(c1)OCO2)c1ccc(NC2CC2)c([N+](=O)[O-])c1.
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide?
The InChIKey is VXMCIQNUHLKITJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O5/c21-17(19-12-4-6-15-16(8-12)25-9-24-15)10-1-5-13(18-11-2-3-11)14(7-10)20(22)23/h1,4-8,11,18H,2-3,9H2,(H,19,21).
What are the key properties of N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide?
N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide has a molecular weight of 341.32 g/mol, XLogP of 3.15, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-4-(cyclopropylamino)-3-nitrobenzamide is sourced from PubChem (CID 4779513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).