C15H19ClN2O3 — CID 4779688
4-chloro-N-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]benzamide (PubChem CID 4779688) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-N-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4779688 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-chloro-N-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]benzamide |
| SMILES | CC1CN(C(=O)CNC(=O)c2ccc(Cl)cc2)CC(C)O1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-10-8-18(9-11(2)21-10)14(19)7-17-15(20)12-3-5-13(16)6-4-12/h3-6,10-11H,7-9H2,1-2H3,(H,17,20) |
| InChIKey | QYKGOGOKEKVEJA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |