About [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate (PubChem CID 4779735) has the molecular formula C18H26N2O6S
and a molecular weight of 398.48 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
| PubChem CID | 4779735 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)OCC(=O)N(CC(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26N2O6S/c1-4-25-17-15(6-5-8-19-17)18(22)26-11-16(21)20(10-13(2)3)14-7-9-27(23,24)12-14/h5-6,8,13-14H,4,7,9-12H2,1-3H3 |
| InChIKey | BPRULHNWBMRDLB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate (CID 4779735) is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate is CCOc1ncccc1C(=O)OCC(=O)N(CC(C)C)C1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate?
The InChIKey is BPRULHNWBMRDLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O6S/c1-4-25-17-15(6-5-8-19-17)18(22)26-11-16(21)20(10-13(2)3)14-7-9-27(23,24)12-14/h5-6,8,13-14H,4,7,9-12H2,1-3H3.
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate?
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate has a molecular weight of 398.48 g/mol, XLogP of 1.31, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate is sourced from PubChem (CID 4779735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).