About 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide
5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide (PubChem CID 47797834) has the molecular formula C17H19F2N3O3
and a molecular weight of 351.35 g/mol. Its IUPAC name is 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide |
| PubChem CID | 47797834 |
| Molecular Formula | C17H19F2N3O3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide |
| SMILES | CCN(CC)Cc1ccc(C(=O)NNC(=O)c2ccc(F)c(F)c2)o1 |
| InChI | InChI=1S/C17H19F2N3O3/c1-3-22(4-2)10-12-6-8-15(25-12)17(24)21-20-16(23)11-5-7-13(18)14(19)9-11/h5-9H,3-4,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | HFAJEYJLEIKHKL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide?
The IUPAC name of 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide (CID 47797834) is 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide.
What is the SMILES notation for 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide?
The canonical SMILES for 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide is CCN(CC)Cc1ccc(C(=O)NNC(=O)c2ccc(F)c(F)c2)o1.
What is the InChIKey of 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide?
The InChIKey is HFAJEYJLEIKHKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2N3O3/c1-3-22(4-2)10-12-6-8-15(25-12)17(24)21-20-16(23)11-5-7-13(18)14(19)9-11/h5-9H,3-4,10H2,1-2H3,(H,20,23)(H,21,24).
What are the key properties of 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide?
5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide has a molecular weight of 351.35 g/mol, XLogP of 2.47, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethylaminomethyl)-N'-(3,4-difluorobenzoyl)furan-2-carbohydrazide is sourced from PubChem (CID 47797834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).