C20H22Cl2N2O5S — CID 4779883
2,4-dichloro-5-[(2-methoxyphenyl)methylsulfamoyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 4779883) has the molecular formula C20H22Cl2N2O5S and a molecular weight of 473.38 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2-methoxyphenyl)methylsulfamoyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2,4-dichloro-5-[(2-methoxyphenyl)methylsulfamoyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4779883 |
| Molecular Formula | C20H22Cl2N2O5S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 2,4-dichloro-5-[(2-methoxyphenyl)methylsulfamoyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1CNS(=O)(=O)c1cc(C(=O)NCC2CCCO2)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O5S/c1-28-18-7-3-2-5-13(18)11-24-30(26,27)19-9-15(16(21)10-17(19)22)20(25)23-12-14-6-4-8-29-14/h2-3,5,7,9-10,14,24H,4,6,8,11-12H2,1H3,(H,23,25) |
| InChIKey | HBIDNHBZIKHADY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |