About 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine
4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine (PubChem CID 4780564) has the molecular formula C13H15N5
and a molecular weight of 241.30 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine |
| PubChem CID | 4780564 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine |
| SMILES | Cc1ccc(-n2ncc(C3=NCCN3)c2N)cc1 |
| InChI | InChI=1S/C13H15N5/c1-9-2-4-10(5-3-9)18-12(14)11(8-17-18)13-15-6-7-16-13/h2-5,8H,6-7,14H2,1H3,(H,15,16) |
| InChIKey | REACXROHQHSLOQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine?
The IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine (CID 4780564) is 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine.
What is the SMILES notation for 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine?
The canonical SMILES for 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine is Cc1ccc(-n2ncc(C3=NCCN3)c2N)cc1.
What is the InChIKey of 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine?
The InChIKey is REACXROHQHSLOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5/c1-9-2-4-10(5-3-9)18-12(14)11(8-17-18)13-15-6-7-16-13/h2-5,8H,6-7,14H2,1H3,(H,15,16).
What are the key properties of 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine?
4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine has a molecular weight of 241.30 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1H-imidazol-2-yl)-1-(4-methylphenyl)pyrazol-5-amine is sourced from PubChem (CID 4780564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).