C26H37N3O4 — CID 4780704
N,N-dicyclohexyl-2-[4-[(2-methoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 4780704) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-[4-[(2-methoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N,N-dicyclohexyl-2-[4-[(2-methoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 4780704 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | N,N-dicyclohexyl-2-[4-[(2-methoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccccc1CC1(C)NC(=O)N(CC(=O)N(C2CCCCC2)C2CCCCC2)C1=O |
| InChI | InChI=1S/C26H37N3O4/c1-26(17-19-11-9-10-16-22(19)33-2)24(31)28(25(32)27-26)18-23(30)29(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h9-11,16,20-21H,3-8,12-15,17-18H2,1-2H3,(H,27,32) |
| InChIKey | DVAZGPPPIBNXDP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|