C18H17N5S3 — CID 4780946
2-methyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidine (PubChem CID 4780946) has the molecular formula C18H17N5S3 and a molecular weight of 399.57 g/mol. Its IUPAC name is 2-methyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidine.
| Compound Name | 2-methyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 4780946 |
| Molecular Formula | C18H17N5S3 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-methyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidine |
| SMILES | Cc1nc(Sc2nnc3n2CCCCC3)c2c(-c3cccs3)csc2n1 |
| InChI | InChI=1S/C18H17N5S3/c1-11-19-16-15(12(10-25-16)13-6-5-9-24-13)17(20-11)26-18-22-21-14-7-3-2-4-8-23(14)18/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | TUQZRKNXOGNZEF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |