About [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate (PubChem CID 4780980) has the molecular formula C23H25ClN2O6
and a molecular weight of 460.91 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
| PubChem CID | 4780980 |
| Molecular Formula | C23H25ClN2O6 |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)C2CCN(C(=O)c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C23H25ClN2O6/c1-30-18-7-8-20(31-2)19(13-18)25-21(27)14-32-23(29)16-9-11-26(12-10-16)22(28)15-3-5-17(24)6-4-15/h3-8,13,16H,9-12,14H2,1-2H3,(H,25,27) |
| InChIKey | WCQKOCWBMBEJLL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate?
The IUPAC name of [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate (CID 4780980) is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate.
What is the SMILES notation for [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate?
The canonical SMILES for [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate is COc1ccc(OC)c(NC(=O)COC(=O)C2CCN(C(=O)c3ccc(Cl)cc3)CC2)c1.
What is the InChIKey of [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate?
The InChIKey is WCQKOCWBMBEJLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25ClN2O6/c1-30-18-7-8-20(31-2)19(13-18)25-21(27)14-32-23(29)16-9-11-26(12-10-16)22(28)15-3-5-17(24)6-4-15/h3-8,13,16H,9-12,14H2,1-2H3,(H,25,27).
What are the key properties of [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate?
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate has a molecular weight of 460.91 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate is sourced from PubChem (CID 4780980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).