C13H21F6N3O2 — CID 47810065
2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 47810065) has the molecular formula C13H21F6N3O2 and a molecular weight of 365.32 g/mol. Its IUPAC name is 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 47810065 |
| Molecular Formula | C13H21F6N3O2 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CN1CCN(CCCOCC(F)(F)F)CC1)NCC(F)(F)F |
| InChI | InChI=1S/C13H21F6N3O2/c14-12(15,16)9-20-11(23)8-22-5-3-21(4-6-22)2-1-7-24-10-13(17,18)19/h1-10H2,(H,20,23) |
| InChIKey | WWPMLTMULRMJCG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|