C18H21N5O2S — CID 4781154
3,3-dimethyl-4-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-1H-quinoxalin-2-one (PubChem CID 4781154) has the molecular formula C18H21N5O2S and a molecular weight of 371.47 g/mol. Its IUPAC name is 3,3-dimethyl-4-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-1H-quinoxalin-2-one.
| Compound Name | 3,3-dimethyl-4-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 4781154 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3,3-dimethyl-4-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-1H-quinoxalin-2-one |
| SMILES | C=CCn1c(C)nnc1SCC(=O)N1c2ccccc2NC(=O)C1(C)C |
| InChI | InChI=1S/C18H21N5O2S/c1-5-10-22-12(2)20-21-17(22)26-11-15(24)23-14-9-7-6-8-13(14)19-16(25)18(23,3)4/h5-9H,1,10-11H2,2-4H3,(H,19,25) |
| InChIKey | SSLFTVUKBRRKSJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|