C13H20N4S — CID 4781352
N',N'-diethyl-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,3-diamine (PubChem CID 4781352) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is N',N'-diethyl-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4781352 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N',N'-diethyl-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1ncnc2sccc12 |
| InChI | InChI=1S/C13H20N4S/c1-3-17(4-2)8-5-7-14-12-11-6-9-18-13(11)16-10-15-12/h6,9-10H,3-5,7-8H2,1-2H3,(H,14,15,16) |
| InChIKey | KDFICYKMHHKRGC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|