C16H27N5O3S — CID 47813826
N-(1-ethylpyrazol-4-yl)-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide (PubChem CID 47813826) has the molecular formula C16H27N5O3S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-(1-ethylpyrazol-4-yl)-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(1-ethylpyrazol-4-yl)-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 47813826 |
| Molecular Formula | C16H27N5O3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-(1-ethylpyrazol-4-yl)-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CCn1cc(NC(=O)C2CCN(S(=O)(=O)N3CCCCC3)CC2)cn1 |
| InChI | InChI=1S/C16H27N5O3S/c1-2-19-13-15(12-17-19)18-16(22)14-6-10-21(11-7-14)25(23,24)20-8-4-3-5-9-20/h12-14H,2-11H2,1H3,(H,18,22) |
| InChIKey | AOONGKZPSPIOHQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |