C19H19N3O3S — CID 4781530
N-ethyl-2-oxo-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-1H-quinoline-4-carboxamide (PubChem CID 4781530) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is N-ethyl-2-oxo-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-1H-quinoline-4-carboxamide.
| Compound Name | N-ethyl-2-oxo-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4781530 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-ethyl-2-oxo-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-1H-quinoline-4-carboxamide |
| SMILES | CCN(CC(=O)NCc1cccs1)C(=O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H19N3O3S/c1-2-22(12-18(24)20-11-13-6-5-9-26-13)19(25)15-10-17(23)21-16-8-4-3-7-14(15)16/h3-10H,2,11-12H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | IHZSTGPFYNUKOR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |