C23H28N4O2 — CID 47818397
3-[[2,3-dihydro-1H-inden-1-yl(methyl)carbamoyl]amino]-4-piperidin-1-ylbenzamide (PubChem CID 47818397) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-[[2,3-dihydro-1H-inden-1-yl(methyl)carbamoyl]amino]-4-piperidin-1-ylbenzamide.
| Compound Name | 3-[[2,3-dihydro-1H-inden-1-yl(methyl)carbamoyl]amino]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 47818397 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 3-[[2,3-dihydro-1H-inden-1-yl(methyl)carbamoyl]amino]-4-piperidin-1-ylbenzamide |
| SMILES | CN(C(=O)Nc1cc(C(N)=O)ccc1N1CCCCC1)C1CCc2ccccc21 |
| InChI | InChI=1S/C23H28N4O2/c1-26(20-11-9-16-7-3-4-8-18(16)20)23(29)25-19-15-17(22(24)28)10-12-21(19)27-13-5-2-6-14-27/h3-4,7-8,10,12,15,20H,2,5-6,9,11,13-14H2,1H3,(H2,24,28)(H,25,29) |
| InChIKey | MFZGCEMONZEXFT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |