C17H17ClN2O5 — CID 4782073
[2-(3-chlorophenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 4782073) has the molecular formula C17H17ClN2O5 and a molecular weight of 364.79 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-(3-chlorophenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 4782073 |
| Molecular Formula | C17H17ClN2O5 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [2-(3-chlorophenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)OCC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2O5/c18-12-5-3-4-11(8-12)13(21)10-25-14(22)9-20-15(23)17(19-16(20)24)6-1-2-7-17/h3-5,8H,1-2,6-7,9-10H2,(H,19,24) |
| InChIKey | DNWLJBLHENFKRG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|