C21H19N5OS2 — CID 4782102
N-[2-(cyanomethylsulfanyl)phenyl]-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 4782102) has the molecular formula C21H19N5OS2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4782102 |
| Molecular Formula | C21H19N5OS2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2SCC#N)nnc1-c1ccccc1 |
| InChI | InChI=1S/C21H19N5OS2/c1-2-13-26-20(16-8-4-3-5-9-16)24-25-21(26)29-15-19(27)23-17-10-6-7-11-18(17)28-14-12-22/h2-11H,1,13-15H2,(H,23,27) |
| InChIKey | LKBWFFFTHQCJHP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|