About [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate
[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate (PubChem CID 4782126) has the molecular formula C20H21NO3
and a molecular weight of 323.39 g/mol. Its IUPAC name is [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate.
Molecular Properties
| Compound Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate |
| PubChem CID | 4782126 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)N2c3ccccc3CC2C)c1C |
| InChI | InChI=1S/C20H21NO3/c1-13-7-6-9-17(15(13)3)20(23)24-12-19(22)21-14(2)11-16-8-4-5-10-18(16)21/h4-10,14H,11-12H2,1-3H3 |
| InChIKey | FJZDJFMMTZUJKA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate?
The IUPAC name of [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate (CID 4782126) is [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate.
What is the SMILES notation for [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate?
The canonical SMILES for [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate is Cc1cccc(C(=O)OCC(=O)N2c3ccccc3CC2C)c1C.
What is the InChIKey of [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate?
The InChIKey is FJZDJFMMTZUJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO3/c1-13-7-6-9-17(15(13)3)20(23)24-12-19(22)21-14(2)11-16-8-4-5-10-18(16)21/h4-10,14H,11-12H2,1-3H3.
What are the key properties of [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate?
[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate has a molecular weight of 323.39 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2,3-dimethylbenzoate is sourced from PubChem (CID 4782126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).