C18H14N4O2S2 — CID 4782545
pyrimidin-2-ylsulfanylmethyl 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 4782545) has the molecular formula C18H14N4O2S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is pyrimidin-2-ylsulfanylmethyl 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | pyrimidin-2-ylsulfanylmethyl 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 4782545 |
| Molecular Formula | C18H14N4O2S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | pyrimidin-2-ylsulfanylmethyl 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)OCSc3ncccn3)cc12 |
| InChI | InChI=1S/C18H14N4O2S2/c1-12-14-10-15(17(23)24-11-25-18-19-8-5-9-20-18)26-16(14)22(21-12)13-6-3-2-4-7-13/h2-10H,11H2,1H3 |
| InChIKey | GIVBPXXGFKIMDF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|