About N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide
N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide (PubChem CID 47826201) has the molecular formula C10H17N5O2
and a molecular weight of 239.28 g/mol. Its IUPAC name is N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide.
Molecular Properties
| Compound Name | N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide |
| PubChem CID | 47826201 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide |
| SMILES | CCCCNC(=O)CNC(=O)Cn1cncn1 |
| InChI | InChI=1S/C10H17N5O2/c1-2-3-4-12-9(16)5-13-10(17)6-15-8-11-7-14-15/h7-8H,2-6H2,1H3,(H,12,16)(H,13,17) |
| InChIKey | LTDCJRAQIRJBME-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide?
The IUPAC name of N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide (CID 47826201) is N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide.
What is the SMILES notation for N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide?
The canonical SMILES for N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide is CCCCNC(=O)CNC(=O)Cn1cncn1.
What is the InChIKey of N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide?
The InChIKey is LTDCJRAQIRJBME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O2/c1-2-3-4-12-9(16)5-13-10(17)6-15-8-11-7-14-15/h7-8H,2-6H2,1H3,(H,12,16)(H,13,17).
What are the key properties of N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide?
N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide has a molecular weight of 239.28 g/mol, XLogP of -0.69, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]acetamide is sourced from PubChem (CID 47826201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).