C23H20ClN3O4S — CID 4782661
2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenoxy]-N-(3-cyanophenyl)propanamide (PubChem CID 4782661) has the molecular formula C23H20ClN3O4S and a molecular weight of 469.95 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenoxy]-N-(3-cyanophenyl)propanamide.
| Compound Name | 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenoxy]-N-(3-cyanophenyl)propanamide |
|---|---|
| PubChem CID | 4782661 |
| Molecular Formula | C23H20ClN3O4S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenoxy]-N-(3-cyanophenyl)propanamide |
| SMILES | CC(Oc1ccc(N(C)S(=O)(=O)c2ccc(Cl)cc2)cc1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C23H20ClN3O4S/c1-16(23(28)26-19-5-3-4-17(14-19)15-25)31-21-10-8-20(9-11-21)27(2)32(29,30)22-12-6-18(24)7-13-22/h3-14,16H,1-2H3,(H,26,28) |
| InChIKey | AFYPXTOIEWCSDF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |