About [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea
[1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea (PubChem CID 4782745) has the molecular formula C22H28N4O2
and a molecular weight of 380.49 g/mol. Its IUPAC name is [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea.
Molecular Properties
| Compound Name | [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea |
| PubChem CID | 4782745 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea |
| SMILES | Cc1cccc(N2CCN(C(=O)C(Cc3ccccc3)NC(N)=O)CC2)c1C |
| InChI | InChI=1S/C22H28N4O2/c1-16-7-6-10-20(17(16)2)25-11-13-26(14-12-25)21(27)19(24-22(23)28)15-18-8-4-3-5-9-18/h3-10,19H,11-15H2,1-2H3,(H3,23,24,28) |
| InChIKey | WFNWOOKZFGPZBZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea?
The IUPAC name of [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea (CID 4782745) is [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea.
What is the SMILES notation for [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea?
The canonical SMILES for [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea is Cc1cccc(N2CCN(C(=O)C(Cc3ccccc3)NC(N)=O)CC2)c1C.
What is the InChIKey of [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea?
The InChIKey is WFNWOOKZFGPZBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4O2/c1-16-7-6-10-20(17(16)2)25-11-13-26(14-12-25)21(27)19(24-22(23)28)15-18-8-4-3-5-9-18/h3-10,19H,11-15H2,1-2H3,(H3,23,24,28).
What are the key properties of [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea?
[1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea has a molecular weight of 380.49 g/mol, XLogP of 2.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]urea is sourced from PubChem (CID 4782745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).