About 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide
2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 4782913) has the molecular formula C23H24N2O3
and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide |
| PubChem CID | 4782913 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CNC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-27-19-13-14-21(28-2)20(15-19)25-22(26)16-24-23(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-15,23-24H,16H2,1-2H3,(H,25,26) |
| InChIKey | RBSWBMCQCKXEHK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide?
The IUPAC name of 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide (CID 4782913) is 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide.
What is the SMILES notation for 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide?
The canonical SMILES for 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide is COc1ccc(OC)c(NC(=O)CNC(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide?
The InChIKey is RBSWBMCQCKXEHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O3/c1-27-19-13-14-21(28-2)20(15-19)25-22(26)16-24-23(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-15,23-24H,16H2,1-2H3,(H,25,26).
What are the key properties of 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide?
2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide has a molecular weight of 376.46 g/mol, XLogP of 4.02, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzhydrylamino)-N-(2,5-dimethoxyphenyl)acetamide is sourced from PubChem (CID 4782913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).